C12H13IN2S — CID 65479206
1-(4-iodophenyl)-N-[(2-methyl-1,3-thiazol-4-yl)methyl]methanamine (PubChem CID 65479206) has the molecular formula C12H13IN2S and a molecular weight of 344.22 g/mol. Its IUPAC name is 1-(4-iodophenyl)-N-[(2-methyl-1,3-thiazol-4-yl)methyl]methanamine.
| Compound Name | 1-(4-iodophenyl)-N-[(2-methyl-1,3-thiazol-4-yl)methyl]methanamine |
|---|---|
| PubChem CID | 65479206 |
| Molecular Formula | C12H13IN2S |
| Molecular Weight | 344.22 g/mol |
| Exact Mass | 343.98 |
| IUPAC Name | 1-(4-iodophenyl)-N-[(2-methyl-1,3-thiazol-4-yl)methyl]methanamine |
| SMILES | Cc1nc(CNCc2ccc(I)cc2)cs1 |
| InChI | InChI=1S/C12H13IN2S/c1-9-15-12(8-16-9)7-14-6-10-2-4-11(13)5-3-10/h2-5,8,14H,6-7H2,1H3 |
| InChIKey | ZUMUOUOMZXOTIL-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.22 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|