C12H17IN2S — CID 65479432
2-[(4-iodophenyl)methyl-propan-2-ylamino]ethanethioamide (PubChem CID 65479432) has the molecular formula C12H17IN2S and a molecular weight of 348.25 g/mol. Its IUPAC name is 2-[(4-iodophenyl)methyl-propan-2-ylamino]ethanethioamide.
| Compound Name | 2-[(4-iodophenyl)methyl-propan-2-ylamino]ethanethioamide |
|---|---|
| PubChem CID | 65479432 |
| Molecular Formula | C12H17IN2S |
| Molecular Weight | 348.25 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | 2-[(4-iodophenyl)methyl-propan-2-ylamino]ethanethioamide |
| SMILES | CC(C)N(CC(N)=S)Cc1ccc(I)cc1 |
| InChI | InChI=1S/C12H17IN2S/c1-9(2)15(8-12(14)16)7-10-3-5-11(13)6-4-10/h3-6,9H,7-8H2,1-2H3,(H2,14,16) |
| InChIKey | ROVJYWVVVFNGQG-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.25 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|