C12H11FN4O — CID 65479896
N-(5-fluoro-2-pyridinyl)-2-(methylamino)pyridine-4-carboxamide (PubChem CID 65479896) has the molecular formula C12H11FN4O and a molecular weight of 246.25 g/mol. Its IUPAC name is N-(5-fluoro-2-pyridinyl)-2-(methylamino)pyridine-4-carboxamide.
| Compound Name | N-(5-fluoro-2-pyridinyl)-2-(methylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 65479896 |
| Molecular Formula | C12H11FN4O |
| Molecular Weight | 246.25 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | N-(5-fluoro-2-pyridinyl)-2-(methylamino)pyridine-4-carboxamide |
| SMILES | CNc1cc(C(=O)Nc2ccc(F)cn2)ccn1 |
| InChI | InChI=1S/C12H11FN4O/c1-14-11-6-8(4-5-15-11)12(18)17-10-3-2-9(13)7-16-10/h2-7H,1H3,(H,14,15)(H,16,17,18) |
| InChIKey | GOLLRVVOLAHBEV-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.25 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |