C12H8Cl2FN3O — CID 65480857
3-amino-4,5-dichloro-N-(5-fluoro-2-pyridinyl)benzamide (PubChem CID 65480857) has the molecular formula C12H8Cl2FN3O and a molecular weight of 300.12 g/mol. Its IUPAC name is 3-amino-4,5-dichloro-N-(5-fluoro-2-pyridinyl)benzamide.
| Compound Name | 3-amino-4,5-dichloro-N-(5-fluoro-2-pyridinyl)benzamide |
|---|---|
| PubChem CID | 65480857 |
| Molecular Formula | C12H8Cl2FN3O |
| Molecular Weight | 300.12 g/mol |
| Exact Mass | 299.00 |
| IUPAC Name | 3-amino-4,5-dichloro-N-(5-fluoro-2-pyridinyl)benzamide |
| SMILES | Nc1cc(C(=O)Nc2ccc(F)cn2)cc(Cl)c1Cl |
| InChI | InChI=1S/C12H8Cl2FN3O/c13-8-3-6(4-9(16)11(8)14)12(19)18-10-2-1-7(15)5-17-10/h1-5H,16H2,(H,17,18,19) |
| InChIKey | VYOXVSSCTVKMQC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.12 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|