C13H9Br4NO2S — CID 65481192
4-(bromomethyl)-N-(2,4,6-tribromophenyl)benzenesulfonamide (PubChem CID 65481192) has the molecular formula C13H9Br4NO2S and a molecular weight of 562.90 g/mol. Its IUPAC name is 4-(bromomethyl)-N-(2,4,6-tribromophenyl)benzenesulfonamide.
| Compound Name | 4-(bromomethyl)-N-(2,4,6-tribromophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 65481192 |
| Molecular Formula | C13H9Br4NO2S |
| Molecular Weight | 562.90 g/mol |
| Exact Mass | 558.71 |
| IUPAC Name | 4-(bromomethyl)-N-(2,4,6-tribromophenyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1c(Br)cc(Br)cc1Br)c1ccc(CBr)cc1 |
| InChI | InChI=1S/C13H9Br4NO2S/c14-7-8-1-3-10(4-2-8)21(19,20)18-13-11(16)5-9(15)6-12(13)17/h1-6,18H,7H2 |
| InChIKey | RJBGTRDPLFUIOW-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.90 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|