C11H24N2O2 — CID 65482115
1-[[1-(2-aminoethyl)cyclopropyl]methyl-methylamino]-3-methoxypropan-2-ol (PubChem CID 65482115) has the molecular formula C11H24N2O2 and a molecular weight of 216.32 g/mol. Its IUPAC name is 1-[[1-(2-aminoethyl)cyclopropyl]methyl-methylamino]-3-methoxypropan-2-ol.
| Compound Name | 1-[[1-(2-aminoethyl)cyclopropyl]methyl-methylamino]-3-methoxypropan-2-ol |
|---|---|
| PubChem CID | 65482115 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | 1-[[1-(2-aminoethyl)cyclopropyl]methyl-methylamino]-3-methoxypropan-2-ol |
| SMILES | COCC(O)CN(C)CC1(CCN)CC1 |
| InChI | InChI=1S/C11H24N2O2/c1-13(7-10(14)8-15-2)9-11(3-4-11)5-6-12/h10,14H,3-9,12H2,1-2H3 |
| InChIKey | SGXDUTQBWFTPGU-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |