C15H15N3O2 — CID 65483071
5-methoxy-2-[(3-methoxyphenyl)methyl]-1H-imidazo[4,5-b]pyridine (PubChem CID 65483071) has the molecular formula C15H15N3O2 and a molecular weight of 269.30 g/mol. Its IUPAC name is 5-methoxy-2-[(3-methoxyphenyl)methyl]-1H-imidazo[4,5-b]pyridine.
| Compound Name | 5-methoxy-2-[(3-methoxyphenyl)methyl]-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 65483071 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 5-methoxy-2-[(3-methoxyphenyl)methyl]-1H-imidazo[4,5-b]pyridine |
| SMILES | COc1cccc(Cc2nc3nc(OC)ccc3[nH]2)c1 |
| InChI | InChI=1S/C15H15N3O2/c1-19-11-5-3-4-10(8-11)9-13-16-12-6-7-14(20-2)18-15(12)17-13/h3-8H,9H2,1-2H3,(H,16,17,18) |
| InChIKey | KVHZJDGVSVEMDA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |