C14H19F3N2O2 — CID 65483564
N-[4-(aminomethyl)-3-(trifluoromethyl)phenyl]-3-propoxypropanamide (PubChem CID 65483564) has the molecular formula C14H19F3N2O2 and a molecular weight of 304.31 g/mol. Its IUPAC name is N-[4-(aminomethyl)-3-(trifluoromethyl)phenyl]-3-propoxypropanamide.
| Compound Name | N-[4-(aminomethyl)-3-(trifluoromethyl)phenyl]-3-propoxypropanamide |
|---|---|
| PubChem CID | 65483564 |
| Molecular Formula | C14H19F3N2O2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | N-[4-(aminomethyl)-3-(trifluoromethyl)phenyl]-3-propoxypropanamide |
| SMILES | CCCOCCC(=O)Nc1ccc(CN)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H19F3N2O2/c1-2-6-21-7-5-13(20)19-11-4-3-10(9-18)12(8-11)14(15,16)17/h3-4,8H,2,5-7,9,18H2,1H3,(H,19,20) |
| InChIKey | FMZLOWLBZMPOKW-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|