C15H15ClN4O — CID 65483753
5-[1-[(2-chloro-4-methyl-3-pyridinyl)amino]ethyl]-1,3-dihydrobenzimidazol-2-one (PubChem CID 65483753) has the molecular formula C15H15ClN4O and a molecular weight of 302.77 g/mol. Its IUPAC name is 5-[1-[(2-chloro-4-methyl-3-pyridinyl)amino]ethyl]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-[1-[(2-chloro-4-methyl-3-pyridinyl)amino]ethyl]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 65483753 |
| Molecular Formula | C15H15ClN4O |
| Molecular Weight | 302.77 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 5-[1-[(2-chloro-4-methyl-3-pyridinyl)amino]ethyl]-1,3-dihydrobenzimidazol-2-one |
| SMILES | Cc1ccnc(Cl)c1NC(C)c1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C15H15ClN4O/c1-8-5-6-17-14(16)13(8)18-9(2)10-3-4-11-12(7-10)20-15(21)19-11/h3-7,9,18H,1-2H3,(H2,19,20,21) |
| InChIKey | QBETUHVQLLTUNA-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 73.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.77 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|