About 4-bromo-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-2-(trifluoromethyl)aniline
4-bromo-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-2-(trifluoromethyl)aniline (PubChem CID 65484192) has the molecular formula C11H10BrF3N4
and a molecular weight of 335.13 g/mol. Its IUPAC name is 4-bromo-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-2-(trifluoromethyl)aniline.
Molecular Properties
| Compound Name | 4-bromo-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-2-(trifluoromethyl)aniline |
| PubChem CID | 65484192 |
| Molecular Formula | C11H10BrF3N4 |
| Molecular Weight | 335.13 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | 4-bromo-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-2-(trifluoromethyl)aniline |
| SMILES | Cn1cnnc1CNc1ccc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C11H10BrF3N4/c1-19-6-17-18-10(19)5-16-9-3-2-7(12)4-8(9)11(13,14)15/h2-4,6,16H,5H2,1H3 |
| InChIKey | UPKBQUURFXFAEE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.13 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-bromo-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-2-(trifluoromethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-2-(trifluoromethyl)aniline?
The IUPAC name of 4-bromo-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-2-(trifluoromethyl)aniline (CID 65484192) is 4-bromo-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-2-(trifluoromethyl)aniline.
What is the SMILES notation for 4-bromo-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-2-(trifluoromethyl)aniline?
The canonical SMILES for 4-bromo-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-2-(trifluoromethyl)aniline is Cn1cnnc1CNc1ccc(Br)cc1C(F)(F)F.
What is the InChIKey of 4-bromo-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-2-(trifluoromethyl)aniline?
The InChIKey is UPKBQUURFXFAEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10BrF3N4/c1-19-6-17-18-10(19)5-16-9-3-2-7(12)4-8(9)11(13,14)15/h2-4,6,16H,5H2,1H3.
What are the key properties of 4-bromo-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-2-(trifluoromethyl)aniline?
4-bromo-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-2-(trifluoromethyl)aniline has a molecular weight of 335.13 g/mol, XLogP of 3.21, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-2-(trifluoromethyl)aniline is sourced from PubChem (CID 65484192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).