About 2-(2,3-dihydro-1H-indol-2-yl)-5-methoxy-1H-imidazo[4,5-b]pyridine
2-(2,3-dihydro-1H-indol-2-yl)-5-methoxy-1H-imidazo[4,5-b]pyridine (PubChem CID 65485005) has the molecular formula C15H14N4O
and a molecular weight of 266.30 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-indol-2-yl)-5-methoxy-1H-imidazo[4,5-b]pyridine.
Molecular Properties
| Compound Name | 2-(2,3-dihydro-1H-indol-2-yl)-5-methoxy-1H-imidazo[4,5-b]pyridine |
| PubChem CID | 65485005 |
| Molecular Formula | C15H14N4O |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 2-(2,3-dihydro-1H-indol-2-yl)-5-methoxy-1H-imidazo[4,5-b]pyridine |
| SMILES | COc1ccc2[nH]c(C3Cc4ccccc4N3)nc2n1 |
| InChI | InChI=1S/C15H14N4O/c1-20-13-7-6-11-14(18-13)19-15(17-11)12-8-9-4-2-3-5-10(9)16-12/h2-7,12,16H,8H2,1H3,(H,17,18,19) |
| InChIKey | ZRGFFYULBKWNAN-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2,3-dihydro-1H-indol-2-yl)-5-methoxy-1H-imidazo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dihydro-1H-indol-2-yl)-5-methoxy-1H-imidazo[4,5-b]pyridine?
The IUPAC name of 2-(2,3-dihydro-1H-indol-2-yl)-5-methoxy-1H-imidazo[4,5-b]pyridine (CID 65485005) is 2-(2,3-dihydro-1H-indol-2-yl)-5-methoxy-1H-imidazo[4,5-b]pyridine.
What is the SMILES notation for 2-(2,3-dihydro-1H-indol-2-yl)-5-methoxy-1H-imidazo[4,5-b]pyridine?
The canonical SMILES for 2-(2,3-dihydro-1H-indol-2-yl)-5-methoxy-1H-imidazo[4,5-b]pyridine is COc1ccc2[nH]c(C3Cc4ccccc4N3)nc2n1.
What is the InChIKey of 2-(2,3-dihydro-1H-indol-2-yl)-5-methoxy-1H-imidazo[4,5-b]pyridine?
The InChIKey is ZRGFFYULBKWNAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N4O/c1-20-13-7-6-11-14(18-13)19-15(17-11)12-8-9-4-2-3-5-10(9)16-12/h2-7,12,16H,8H2,1H3,(H,17,18,19).
What are the key properties of 2-(2,3-dihydro-1H-indol-2-yl)-5-methoxy-1H-imidazo[4,5-b]pyridine?
2-(2,3-dihydro-1H-indol-2-yl)-5-methoxy-1H-imidazo[4,5-b]pyridine has a molecular weight of 266.30 g/mol, XLogP of 2.68, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dihydro-1H-indol-2-yl)-5-methoxy-1H-imidazo[4,5-b]pyridine is sourced from PubChem (CID 65485005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).