About methyl 3-phenyl-1H-1,2,4-triazole-5-carboxylate
methyl 3-phenyl-1H-1,2,4-triazole-5-carboxylate (PubChem CID 654883) has the molecular formula C10H9N3O2
and a molecular weight of 203.20 g/mol. Its IUPAC name is methyl 3-phenyl-1H-1,2,4-triazole-5-carboxylate.
Molecular Properties
| Compound Name | methyl 3-phenyl-1H-1,2,4-triazole-5-carboxylate |
| PubChem CID | 654883 |
| Molecular Formula | C10H9N3O2 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | methyl 3-phenyl-1H-1,2,4-triazole-5-carboxylate |
| SMILES | COC(=O)c1nc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C10H9N3O2/c1-15-10(14)9-11-8(12-13-9)7-5-3-2-4-6-7/h2-6H,1H3,(H,11,12,13) |
| InChIKey | FGKDFTNNBRZBLZ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 3-phenyl-1H-1,2,4-triazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-phenyl-1H-1,2,4-triazole-5-carboxylate?
The IUPAC name of methyl 3-phenyl-1H-1,2,4-triazole-5-carboxylate (CID 654883) is methyl 3-phenyl-1H-1,2,4-triazole-5-carboxylate.
What is the SMILES notation for methyl 3-phenyl-1H-1,2,4-triazole-5-carboxylate?
The canonical SMILES for methyl 3-phenyl-1H-1,2,4-triazole-5-carboxylate is COC(=O)c1nc(-c2ccccc2)n[nH]1.
What is the InChIKey of methyl 3-phenyl-1H-1,2,4-triazole-5-carboxylate?
The InChIKey is FGKDFTNNBRZBLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O2/c1-15-10(14)9-11-8(12-13-9)7-5-3-2-4-6-7/h2-6H,1H3,(H,11,12,13).
What are the key properties of methyl 3-phenyl-1H-1,2,4-triazole-5-carboxylate?
methyl 3-phenyl-1H-1,2,4-triazole-5-carboxylate has a molecular weight of 203.20 g/mol, XLogP of 1.26, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-phenyl-1H-1,2,4-triazole-5-carboxylate is sourced from PubChem (CID 654883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).