C21H25N3O2 — CID 654890
3-N-(2,3-dimethylphenyl)-1-N-phenylpiperidine-1,3-dicarboxamide (PubChem CID 654890) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 3-N-(2,3-dimethylphenyl)-1-N-phenylpiperidine-1,3-dicarboxamide.
| Compound Name | 3-N-(2,3-dimethylphenyl)-1-N-phenylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 654890 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 3-N-(2,3-dimethylphenyl)-1-N-phenylpiperidine-1,3-dicarboxamide |
| SMILES | Cc1cccc(NC(=O)C2CCCN(C(=O)Nc3ccccc3)C2)c1C |
| InChI | InChI=1S/C21H25N3O2/c1-15-8-6-12-19(16(15)2)23-20(25)17-9-7-13-24(14-17)21(26)22-18-10-4-3-5-11-18/h3-6,8,10-12,17H,7,9,13-14H2,1-2H3,(H,22,26)(H,23,25) |
| InChIKey | NXQNGJCHNZULJU-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |