About 8-ethyl-9-[(4-iodophenyl)methyl]-8-methyl-6,9-diazaspiro[4.5]decane
8-ethyl-9-[(4-iodophenyl)methyl]-8-methyl-6,9-diazaspiro[4.5]decane (PubChem CID 65489382) has the molecular formula C18H27IN2
and a molecular weight of 398.33 g/mol. Its IUPAC name is 8-ethyl-9-[(4-iodophenyl)methyl]-8-methyl-6,9-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | 8-ethyl-9-[(4-iodophenyl)methyl]-8-methyl-6,9-diazaspiro[4.5]decane |
| PubChem CID | 65489382 |
| Molecular Formula | C18H27IN2 |
| Molecular Weight | 398.33 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 8-ethyl-9-[(4-iodophenyl)methyl]-8-methyl-6,9-diazaspiro[4.5]decane |
| SMILES | CCC1(C)CNC2(CCCC2)CN1Cc1ccc(I)cc1 |
| InChI | InChI=1S/C18H27IN2/c1-3-17(2)13-20-18(10-4-5-11-18)14-21(17)12-15-6-8-16(19)9-7-15/h6-9,20H,3-5,10-14H2,1-2H3 |
| InChIKey | AEEPVAXMYILQAR-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.33 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 8-ethyl-9-[(4-iodophenyl)methyl]-8-methyl-6,9-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-ethyl-9-[(4-iodophenyl)methyl]-8-methyl-6,9-diazaspiro[4.5]decane?
The IUPAC name of 8-ethyl-9-[(4-iodophenyl)methyl]-8-methyl-6,9-diazaspiro[4.5]decane (CID 65489382) is 8-ethyl-9-[(4-iodophenyl)methyl]-8-methyl-6,9-diazaspiro[4.5]decane.
What is the SMILES notation for 8-ethyl-9-[(4-iodophenyl)methyl]-8-methyl-6,9-diazaspiro[4.5]decane?
The canonical SMILES for 8-ethyl-9-[(4-iodophenyl)methyl]-8-methyl-6,9-diazaspiro[4.5]decane is CCC1(C)CNC2(CCCC2)CN1Cc1ccc(I)cc1.
What is the InChIKey of 8-ethyl-9-[(4-iodophenyl)methyl]-8-methyl-6,9-diazaspiro[4.5]decane?
The InChIKey is AEEPVAXMYILQAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27IN2/c1-3-17(2)13-20-18(10-4-5-11-18)14-21(17)12-15-6-8-16(19)9-7-15/h6-9,20H,3-5,10-14H2,1-2H3.
What are the key properties of 8-ethyl-9-[(4-iodophenyl)methyl]-8-methyl-6,9-diazaspiro[4.5]decane?
8-ethyl-9-[(4-iodophenyl)methyl]-8-methyl-6,9-diazaspiro[4.5]decane has a molecular weight of 398.33 g/mol, XLogP of 4.18, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-ethyl-9-[(4-iodophenyl)methyl]-8-methyl-6,9-diazaspiro[4.5]decane is sourced from PubChem (CID 65489382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).