C15H17ClN2 — CID 65489501
2-chloro-N-[(3,4-dimethylphenyl)methyl]-4-methylpyridin-3-amine (PubChem CID 65489501) has the molecular formula C15H17ClN2 and a molecular weight of 260.77 g/mol. Its IUPAC name is 2-chloro-N-[(3,4-dimethylphenyl)methyl]-4-methylpyridin-3-amine.
| Compound Name | 2-chloro-N-[(3,4-dimethylphenyl)methyl]-4-methylpyridin-3-amine |
|---|---|
| PubChem CID | 65489501 |
| Molecular Formula | C15H17ClN2 |
| Molecular Weight | 260.77 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 2-chloro-N-[(3,4-dimethylphenyl)methyl]-4-methylpyridin-3-amine |
| SMILES | Cc1ccc(CNc2c(C)ccnc2Cl)cc1C |
| InChI | InChI=1S/C15H17ClN2/c1-10-4-5-13(8-12(10)3)9-18-14-11(2)6-7-17-15(14)16/h4-8,18H,9H2,1-3H3 |
| InChIKey | OYADBLPGBCAVRS-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.77 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|