C14H13BrF3NS — CID 65489813
3-bromo-N-[(5-ethylthiophen-2-yl)methyl]-5-(trifluoromethyl)aniline (PubChem CID 65489813) has the molecular formula C14H13BrF3NS and a molecular weight of 364.23 g/mol. Its IUPAC name is 3-bromo-N-[(5-ethylthiophen-2-yl)methyl]-5-(trifluoromethyl)aniline.
| Compound Name | 3-bromo-N-[(5-ethylthiophen-2-yl)methyl]-5-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 65489813 |
| Molecular Formula | C14H13BrF3NS |
| Molecular Weight | 364.23 g/mol |
| Exact Mass | 362.99 |
| IUPAC Name | 3-bromo-N-[(5-ethylthiophen-2-yl)methyl]-5-(trifluoromethyl)aniline |
| SMILES | CCc1ccc(CNc2cc(Br)cc(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C14H13BrF3NS/c1-2-12-3-4-13(20-12)8-19-11-6-9(14(16,17)18)5-10(15)7-11/h3-7,19H,2,8H2,1H3 |
| InChIKey | UNJARTRYUJAODR-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.23 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |