C9H9ClN2O3 — CID 65490498
3-[(2-chloro-4-methyl-3-pyridinyl)amino]-3-oxopropanoic acid (PubChem CID 65490498) has the molecular formula C9H9ClN2O3 and a molecular weight of 228.63 g/mol. Its IUPAC name is 3-[(2-chloro-4-methyl-3-pyridinyl)amino]-3-oxopropanoic acid.
| Compound Name | 3-[(2-chloro-4-methyl-3-pyridinyl)amino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 65490498 |
| Molecular Formula | C9H9ClN2O3 |
| Molecular Weight | 228.63 g/mol |
| Exact Mass | 228.03 |
| IUPAC Name | 3-[(2-chloro-4-methyl-3-pyridinyl)amino]-3-oxopropanoic acid |
| SMILES | Cc1ccnc(Cl)c1NC(=O)CC(=O)O |
| InChI | InChI=1S/C9H9ClN2O3/c1-5-2-3-11-9(10)8(5)12-6(13)4-7(14)15/h2-3H,4H2,1H3,(H,12,13)(H,14,15) |
| InChIKey | XRGRDYQEZHGHLP-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.63 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|