C18H27IN2 — CID 65490573
6-[(4-iodophenyl)methyl]-8-propyl-6,9-diazaspiro[4.5]decane (PubChem CID 65490573) has the molecular formula C18H27IN2 and a molecular weight of 398.33 g/mol. Its IUPAC name is 6-[(4-iodophenyl)methyl]-8-propyl-6,9-diazaspiro[4.5]decane.
| Compound Name | 6-[(4-iodophenyl)methyl]-8-propyl-6,9-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 65490573 |
| Molecular Formula | C18H27IN2 |
| Molecular Weight | 398.33 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 6-[(4-iodophenyl)methyl]-8-propyl-6,9-diazaspiro[4.5]decane |
| SMILES | CCCC1CN(Cc2ccc(I)cc2)C2(CCCC2)CN1 |
| InChI | InChI=1S/C18H27IN2/c1-2-5-17-13-21(12-15-6-8-16(19)9-7-15)18(14-20-17)10-3-4-11-18/h6-9,17,20H,2-5,10-14H2,1H3 |
| InChIKey | PHLPZYHCKOHTAQ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.33 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|