About 5-cyclopropyl-2,2-diethyl-1-[(4-iodophenyl)methyl]piperazine
5-cyclopropyl-2,2-diethyl-1-[(4-iodophenyl)methyl]piperazine (PubChem CID 65491369) has the molecular formula C18H27IN2
and a molecular weight of 398.33 g/mol. Its IUPAC name is 5-cyclopropyl-2,2-diethyl-1-[(4-iodophenyl)methyl]piperazine.
Molecular Properties
| Compound Name | 5-cyclopropyl-2,2-diethyl-1-[(4-iodophenyl)methyl]piperazine |
| PubChem CID | 65491369 |
| Molecular Formula | C18H27IN2 |
| Molecular Weight | 398.33 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 5-cyclopropyl-2,2-diethyl-1-[(4-iodophenyl)methyl]piperazine |
| SMILES | CCC1(CC)CNC(C2CC2)CN1Cc1ccc(I)cc1 |
| InChI | InChI=1S/C18H27IN2/c1-3-18(4-2)13-20-17(15-7-8-15)12-21(18)11-14-5-9-16(19)10-6-14/h5-6,9-10,15,17,20H,3-4,7-8,11-13H2,1-2H3 |
| InChIKey | KDNCSFOHVXBGNW-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.33 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-cyclopropyl-2,2-diethyl-1-[(4-iodophenyl)methyl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopropyl-2,2-diethyl-1-[(4-iodophenyl)methyl]piperazine?
The IUPAC name of 5-cyclopropyl-2,2-diethyl-1-[(4-iodophenyl)methyl]piperazine (CID 65491369) is 5-cyclopropyl-2,2-diethyl-1-[(4-iodophenyl)methyl]piperazine.
What is the SMILES notation for 5-cyclopropyl-2,2-diethyl-1-[(4-iodophenyl)methyl]piperazine?
The canonical SMILES for 5-cyclopropyl-2,2-diethyl-1-[(4-iodophenyl)methyl]piperazine is CCC1(CC)CNC(C2CC2)CN1Cc1ccc(I)cc1.
What is the InChIKey of 5-cyclopropyl-2,2-diethyl-1-[(4-iodophenyl)methyl]piperazine?
The InChIKey is KDNCSFOHVXBGNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27IN2/c1-3-18(4-2)13-20-17(15-7-8-15)12-21(18)11-14-5-9-16(19)10-6-14/h5-6,9-10,15,17,20H,3-4,7-8,11-13H2,1-2H3.
What are the key properties of 5-cyclopropyl-2,2-diethyl-1-[(4-iodophenyl)methyl]piperazine?
5-cyclopropyl-2,2-diethyl-1-[(4-iodophenyl)methyl]piperazine has a molecular weight of 398.33 g/mol, XLogP of 4.03, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopropyl-2,2-diethyl-1-[(4-iodophenyl)methyl]piperazine is sourced from PubChem (CID 65491369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).