About 2-[1-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]cyclopropyl]acetonitrile
2-[1-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]cyclopropyl]acetonitrile (PubChem CID 65494477) has the molecular formula C9H12N4S
and a molecular weight of 208.29 g/mol. Its IUPAC name is 2-[1-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]cyclopropyl]acetonitrile.
Molecular Properties
| Compound Name | 2-[1-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]cyclopropyl]acetonitrile |
| PubChem CID | 65494477 |
| Molecular Formula | C9H12N4S |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 2-[1-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]cyclopropyl]acetonitrile |
| SMILES | Cc1nc(SCC2(CC#N)CC2)n[nH]1 |
| InChI | InChI=1S/C9H12N4S/c1-7-11-8(13-12-7)14-6-9(2-3-9)4-5-10/h2-4,6H2,1H3,(H,11,12,13) |
| InChIKey | DBPVLIYVZOORCD-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[1-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]cyclopropyl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]cyclopropyl]acetonitrile?
The IUPAC name of 2-[1-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]cyclopropyl]acetonitrile (CID 65494477) is 2-[1-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]cyclopropyl]acetonitrile.
What is the SMILES notation for 2-[1-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]cyclopropyl]acetonitrile?
The canonical SMILES for 2-[1-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]cyclopropyl]acetonitrile is Cc1nc(SCC2(CC#N)CC2)n[nH]1.
What is the InChIKey of 2-[1-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]cyclopropyl]acetonitrile?
The InChIKey is DBPVLIYVZOORCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4S/c1-7-11-8(13-12-7)14-6-9(2-3-9)4-5-10/h2-4,6H2,1H3,(H,11,12,13).
What are the key properties of 2-[1-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]cyclopropyl]acetonitrile?
2-[1-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]cyclopropyl]acetonitrile has a molecular weight of 208.29 g/mol, XLogP of 1.90, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]cyclopropyl]acetonitrile is sourced from PubChem (CID 65494477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).