C12H24N2O3 — CID 65494541
(3S)-5-methyl-3-[[3-(methylamino)propanoylamino]methyl]hexanoic acid (PubChem CID 65494541) has the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. Its IUPAC name is (3S)-5-methyl-3-[[3-(methylamino)propanoylamino]methyl]hexanoic acid.
| Compound Name | (3S)-5-methyl-3-[[3-(methylamino)propanoylamino]methyl]hexanoic acid |
|---|---|
| PubChem CID | 65494541 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | (3S)-5-methyl-3-[[3-(methylamino)propanoylamino]methyl]hexanoic acid |
| SMILES | CNCCC(=O)NC[C@H](CC(=O)O)CC(C)C |
| InChI | InChI=1S/C12H24N2O3/c1-9(2)6-10(7-12(16)17)8-14-11(15)4-5-13-3/h9-10,13H,4-8H2,1-3H3,(H,14,15)(H,16,17)/t10-/m0/s1 |
| InChIKey | IITQMXZLLOTVPY-JTQLQIEISA-N |
| XLogP | 0.85 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |