C14H10BrFN2O2 — CID 65495452
2-[1-[(5-bromo-6-fluoro-2,3-dioxoindol-1-yl)methyl]cyclopropyl]acetonitrile (PubChem CID 65495452) has the molecular formula C14H10BrFN2O2 and a molecular weight of 337.15 g/mol. Its IUPAC name is 2-[1-[(5-bromo-6-fluoro-2,3-dioxoindol-1-yl)methyl]cyclopropyl]acetonitrile.
| Compound Name | 2-[1-[(5-bromo-6-fluoro-2,3-dioxoindol-1-yl)methyl]cyclopropyl]acetonitrile |
|---|---|
| PubChem CID | 65495452 |
| Molecular Formula | C14H10BrFN2O2 |
| Molecular Weight | 337.15 g/mol |
| Exact Mass | 335.99 |
| IUPAC Name | 2-[1-[(5-bromo-6-fluoro-2,3-dioxoindol-1-yl)methyl]cyclopropyl]acetonitrile |
| SMILES | N#CCC1(CN2C(=O)C(=O)c3cc(Br)c(F)cc32)CC1 |
| InChI | InChI=1S/C14H10BrFN2O2/c15-9-5-8-11(6-10(9)16)18(13(20)12(8)19)7-14(1-2-14)3-4-17/h5-6H,1-3,7H2 |
| InChIKey | QXVIXUBJKMDUFP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.15 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|