C12H22N2 — CID 65495825
2-[1-[(2-methylpentan-3-ylamino)methyl]cyclopropyl]acetonitrile (PubChem CID 65495825) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is 2-[1-[(2-methylpentan-3-ylamino)methyl]cyclopropyl]acetonitrile.
| Compound Name | 2-[1-[(2-methylpentan-3-ylamino)methyl]cyclopropyl]acetonitrile |
|---|---|
| PubChem CID | 65495825 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 2-[1-[(2-methylpentan-3-ylamino)methyl]cyclopropyl]acetonitrile |
| SMILES | CCC(NCC1(CC#N)CC1)C(C)C |
| InChI | InChI=1S/C12H22N2/c1-4-11(10(2)3)14-9-12(5-6-12)7-8-13/h10-11,14H,4-7,9H2,1-3H3 |
| InChIKey | KHBMVTNVGLBQEG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |