C12H17N3 — CID 65496491
1-[[1-(cyanomethyl)cyclopropyl]methyl]piperidine-2-carbonitrile (PubChem CID 65496491) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is 1-[[1-(cyanomethyl)cyclopropyl]methyl]piperidine-2-carbonitrile.
| Compound Name | 1-[[1-(cyanomethyl)cyclopropyl]methyl]piperidine-2-carbonitrile |
|---|---|
| PubChem CID | 65496491 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 1-[[1-(cyanomethyl)cyclopropyl]methyl]piperidine-2-carbonitrile |
| SMILES | N#CCC1(CN2CCCCC2C#N)CC1 |
| InChI | InChI=1S/C12H17N3/c13-7-6-12(4-5-12)10-15-8-2-1-3-11(15)9-14/h11H,1-6,8,10H2 |
| InChIKey | TWPHQVIBIHQABK-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |