C14H17NO3 — CID 65497780
2-[1-[[2-(hydroxymethyl)-5-methoxyphenoxy]methyl]cyclopropyl]acetonitrile (PubChem CID 65497780) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is 2-[1-[[2-(hydroxymethyl)-5-methoxyphenoxy]methyl]cyclopropyl]acetonitrile.
| Compound Name | 2-[1-[[2-(hydroxymethyl)-5-methoxyphenoxy]methyl]cyclopropyl]acetonitrile |
|---|---|
| PubChem CID | 65497780 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 2-[1-[[2-(hydroxymethyl)-5-methoxyphenoxy]methyl]cyclopropyl]acetonitrile |
| SMILES | COc1ccc(CO)c(OCC2(CC#N)CC2)c1 |
| InChI | InChI=1S/C14H17NO3/c1-17-12-3-2-11(9-16)13(8-12)18-10-14(4-5-14)6-7-15/h2-3,8,16H,4-6,9-10H2,1H3 |
| InChIKey | WTUGUNSBRIMUOM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |