C13H10BrF2NO2 — CID 65499344
3-(4-bromo-2,6-difluorophenyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione (PubChem CID 65499344) has the molecular formula C13H10BrF2NO2 and a molecular weight of 330.13 g/mol. Its IUPAC name is 3-(4-bromo-2,6-difluorophenyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione.
| Compound Name | 3-(4-bromo-2,6-difluorophenyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione |
|---|---|
| PubChem CID | 65499344 |
| Molecular Formula | C13H10BrF2NO2 |
| Molecular Weight | 330.13 g/mol |
| Exact Mass | 328.99 |
| IUPAC Name | 3-(4-bromo-2,6-difluorophenyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione |
| SMILES | CC1(C)C2C(=O)N(c3c(F)cc(Br)cc3F)C(=O)C21 |
| InChI | InChI=1S/C13H10BrF2NO2/c1-13(2)8-9(13)12(19)17(11(8)18)10-6(15)3-5(14)4-7(10)16/h3-4,8-9H,1-2H3 |
| InChIKey | LGQYOFLHROPXSO-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.13 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|