6-(2,6-dichloroanilino)pyridine-2-carboxylic acid

C12H8Cl2N2O2 — CID 65499397

IUPAC6-(2,6-dichloroanilino)pyridine-2-carboxylic acid
SMILESO=C(O)c1cccc(Nc2c(Cl)cccc2Cl)n1
InChIInChI=1S/C12H8Cl2N2O2/c13-7-3-1-4-8(14)11(7)16-10-6-2-5-9(15-10)12(17)18/h1-6H,(H,15,16)(H,17,18)
InChIKeyCRMWSEIUKLVOBJ-UHFFFAOYSA-N
MW283.11 g/mol
LogP3.83
Rot. Bonds3

About 6-(2,6-dichloroanilino)pyridine-2-carboxylic acid

6-(2,6-dichloroanilino)pyridine-2-carboxylic acid (PubChem CID 65499397) has the molecular formula C12H8Cl2N2O2 and a molecular weight of 283.11 g/mol. Its IUPAC name is 6-(2,6-dichloroanilino)pyridine-2-carboxylic acid.

Molecular Properties

Compound Name6-(2,6-dichloroanilino)pyridine-2-carboxylic acid
PubChem CID65499397
Molecular FormulaC12H8Cl2N2O2
Molecular Weight283.11 g/mol
Exact Mass282.00
IUPAC Name6-(2,6-dichloroanilino)pyridine-2-carboxylic acid
SMILESO=C(O)c1cccc(Nc2c(Cl)cccc2Cl)n1
InChIInChI=1S/C12H8Cl2N2O2/c13-7-3-1-4-8(14)11(7)16-10-6-2-5-9(15-10)12(17)18/h1-6H,(H,15,16)(H,17,18)
InChIKeyCRMWSEIUKLVOBJ-UHFFFAOYSA-N
XLogP3.83
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500283.11
LogP ≤ 53.83
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 6-(2,6-dichloroanilino)pyridine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-(2,6-dichloroanilino)pyridine-2-carboxylic acid?
The IUPAC name of 6-(2,6-dichloroanilino)pyridine-2-carboxylic acid (CID 65499397) is 6-(2,6-dichloroanilino)pyridine-2-carboxylic acid.
What is the SMILES notation for 6-(2,6-dichloroanilino)pyridine-2-carboxylic acid?
The canonical SMILES for 6-(2,6-dichloroanilino)pyridine-2-carboxylic acid is O=C(O)c1cccc(Nc2c(Cl)cccc2Cl)n1.
What is the InChIKey of 6-(2,6-dichloroanilino)pyridine-2-carboxylic acid?
The InChIKey is CRMWSEIUKLVOBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8Cl2N2O2/c13-7-3-1-4-8(14)11(7)16-10-6-2-5-9(15-10)12(17)18/h1-6H,(H,15,16)(H,17,18).
What are the key properties of 6-(2,6-dichloroanilino)pyridine-2-carboxylic acid?
6-(2,6-dichloroanilino)pyridine-2-carboxylic acid has a molecular weight of 283.11 g/mol, XLogP of 3.83, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,6-dichloroanilino)pyridine-2-carboxylic acid is sourced from PubChem (CID 65499397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).