C18H20N2O5 — CID 655012
2-methoxyethyl 2-amino-5-oxo-4-pyridin-3-yl-4,6,7,8-tetrahydrochromene-3-carboxylate (PubChem CID 655012) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is 2-methoxyethyl 2-amino-5-oxo-4-pyridin-3-yl-4,6,7,8-tetrahydrochromene-3-carboxylate.
| Compound Name | 2-methoxyethyl 2-amino-5-oxo-4-pyridin-3-yl-4,6,7,8-tetrahydrochromene-3-carboxylate |
|---|---|
| PubChem CID | 655012 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 2-methoxyethyl 2-amino-5-oxo-4-pyridin-3-yl-4,6,7,8-tetrahydrochromene-3-carboxylate |
| SMILES | COCCOC(=O)C1=C(N)OC2=C(C(=O)CCC2)C1c1cccnc1 |
| InChI | InChI=1S/C18H20N2O5/c1-23-8-9-24-18(22)16-14(11-4-3-7-20-10-11)15-12(21)5-2-6-13(15)25-17(16)19/h3-4,7,10,14H,2,5-6,8-9,19H2,1H3 |
| InChIKey | XPUWWNOYHXWYLC-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 100.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|