About N-(3-methoxypropyl)-N-(4-phenyl-1,3-thiazol-2-yl)acetamide
N-(3-methoxypropyl)-N-(4-phenyl-1,3-thiazol-2-yl)acetamide (PubChem CID 655052) has the molecular formula C15H18N2O2S
and a molecular weight of 290.39 g/mol. Its IUPAC name is N-(3-methoxypropyl)-N-(4-phenyl-1,3-thiazol-2-yl)acetamide.
Molecular Properties
| Compound Name | N-(3-methoxypropyl)-N-(4-phenyl-1,3-thiazol-2-yl)acetamide |
| PubChem CID | 655052 |
| Molecular Formula | C15H18N2O2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | N-(3-methoxypropyl)-N-(4-phenyl-1,3-thiazol-2-yl)acetamide |
| SMILES | COCCCN(C(C)=O)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C15H18N2O2S/c1-12(18)17(9-6-10-19-2)15-16-14(11-20-15)13-7-4-3-5-8-13/h3-5,7-8,11H,6,9-10H2,1-2H3 |
| InChIKey | DATWWTDLSSRZRK-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(3-methoxypropyl)-N-(4-phenyl-1,3-thiazol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methoxypropyl)-N-(4-phenyl-1,3-thiazol-2-yl)acetamide?
The IUPAC name of N-(3-methoxypropyl)-N-(4-phenyl-1,3-thiazol-2-yl)acetamide (CID 655052) is N-(3-methoxypropyl)-N-(4-phenyl-1,3-thiazol-2-yl)acetamide.
What is the SMILES notation for N-(3-methoxypropyl)-N-(4-phenyl-1,3-thiazol-2-yl)acetamide?
The canonical SMILES for N-(3-methoxypropyl)-N-(4-phenyl-1,3-thiazol-2-yl)acetamide is COCCCN(C(C)=O)c1nc(-c2ccccc2)cs1.
What is the InChIKey of N-(3-methoxypropyl)-N-(4-phenyl-1,3-thiazol-2-yl)acetamide?
The InChIKey is DATWWTDLSSRZRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O2S/c1-12(18)17(9-6-10-19-2)15-16-14(11-20-15)13-7-4-3-5-8-13/h3-5,7-8,11H,6,9-10H2,1-2H3.
What are the key properties of N-(3-methoxypropyl)-N-(4-phenyl-1,3-thiazol-2-yl)acetamide?
N-(3-methoxypropyl)-N-(4-phenyl-1,3-thiazol-2-yl)acetamide has a molecular weight of 290.39 g/mol, XLogP of 3.20, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methoxypropyl)-N-(4-phenyl-1,3-thiazol-2-yl)acetamide is sourced from PubChem (CID 655052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).