About N-cyclopentyl-1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxamide
N-cyclopentyl-1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxamide (PubChem CID 655094) has the molecular formula C17H26N4O
and a molecular weight of 302.42 g/mol. Its IUPAC name is N-cyclopentyl-1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxamide.
Molecular Properties
| Compound Name | N-cyclopentyl-1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxamide |
| PubChem CID | 655094 |
| Molecular Formula | C17H26N4O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | N-cyclopentyl-1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxamide |
| SMILES | Cc1cc(C)nc(N2CCCC(C(=O)NC3CCCC3)C2)n1 |
| InChI | InChI=1S/C17H26N4O/c1-12-10-13(2)19-17(18-12)21-9-5-6-14(11-21)16(22)20-15-7-3-4-8-15/h10,14-15H,3-9,11H2,1-2H3,(H,20,22) |
| InChIKey | VGJFCXCNPKHFHX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-cyclopentyl-1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxamide?
The IUPAC name of N-cyclopentyl-1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxamide (CID 655094) is N-cyclopentyl-1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxamide.
What is the SMILES notation for N-cyclopentyl-1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxamide?
The canonical SMILES for N-cyclopentyl-1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxamide is Cc1cc(C)nc(N2CCCC(C(=O)NC3CCCC3)C2)n1.
What is the InChIKey of N-cyclopentyl-1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxamide?
The InChIKey is VGJFCXCNPKHFHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N4O/c1-12-10-13(2)19-17(18-12)21-9-5-6-14(11-21)16(22)20-15-7-3-4-8-15/h10,14-15H,3-9,11H2,1-2H3,(H,20,22).
What are the key properties of N-cyclopentyl-1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxamide?
N-cyclopentyl-1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxamide has a molecular weight of 302.42 g/mol, XLogP of 2.37, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxamide is sourced from PubChem (CID 655094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).