C16H17N3O3 — CID 655187
1-methyl-2-(3,4,5-trimethoxyphenyl)imidazo[4,5-c]pyridine (PubChem CID 655187) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is 1-methyl-2-(3,4,5-trimethoxyphenyl)imidazo[4,5-c]pyridine.
| Compound Name | 1-methyl-2-(3,4,5-trimethoxyphenyl)imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 655187 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 1-methyl-2-(3,4,5-trimethoxyphenyl)imidazo[4,5-c]pyridine |
| SMILES | COc1cc(-c2nc3cnccc3n2C)cc(OC)c1OC |
| InChI | InChI=1S/C16H17N3O3/c1-19-12-5-6-17-9-11(12)18-16(19)10-7-13(20-2)15(22-4)14(8-10)21-3/h5-9H,1-4H3 |
| InChIKey | LUPIYJXFUZXEHE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 58.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |