C15H15N3S2 — CID 655211
N-benzyl-4-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3-thiazol-2-amine (PubChem CID 655211) has the molecular formula C15H15N3S2 and a molecular weight of 301.44 g/mol. Its IUPAC name is N-benzyl-4-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3-thiazol-2-amine.
| Compound Name | N-benzyl-4-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 655211 |
| Molecular Formula | C15H15N3S2 |
| Molecular Weight | 301.44 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | N-benzyl-4-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3-thiazol-2-amine |
| SMILES | Cc1nc(C)c(-c2csc(NCc3ccccc3)n2)s1 |
| InChI | InChI=1S/C15H15N3S2/c1-10-14(20-11(2)17-10)13-9-19-15(18-13)16-8-12-6-4-3-5-7-12/h3-7,9H,8H2,1-2H3,(H,16,18) |
| InChIKey | NNJQVTFINZWWKM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.44 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |