About (3S,4R)-3-(4-methylphenyl)sulfonyl-4-morpholin-4-ylthiolane 1,1-dioxide
(3S,4R)-3-(4-methylphenyl)sulfonyl-4-morpholin-4-ylthiolane 1,1-dioxide (PubChem CID 6552146) has the molecular formula C15H21NO5S2
and a molecular weight of 359.47 g/mol. Its IUPAC name is (3S,4R)-3-(4-methylphenyl)sulfonyl-4-morpholin-4-ylthiolane 1,1-dioxide.
Molecular Properties
| Compound Name | (3S,4R)-3-(4-methylphenyl)sulfonyl-4-morpholin-4-ylthiolane 1,1-dioxide |
| PubChem CID | 6552146 |
| Molecular Formula | C15H21NO5S2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | (3S,4R)-3-(4-methylphenyl)sulfonyl-4-morpholin-4-ylthiolane 1,1-dioxide |
| SMILES | Cc1ccc(S(=O)(=O)[C@@H]2CS(=O)(=O)C[C@H]2N2CCOCC2)cc1 |
| InChI | InChI=1S/C15H21NO5S2/c1-12-2-4-13(5-3-12)23(19,20)15-11-22(17,18)10-14(15)16-6-8-21-9-7-16/h2-5,14-15H,6-11H2,1H3/t14-,15-/m1/s1 |
| InChIKey | NDJRXBUSJQQVOW-HUUCEWRRSA-N |
| XLogP | 0.27 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (3S,4R)-3-(4-methylphenyl)sulfonyl-4-morpholin-4-ylthiolane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4R)-3-(4-methylphenyl)sulfonyl-4-morpholin-4-ylthiolane 1,1-dioxide?
The IUPAC name of (3S,4R)-3-(4-methylphenyl)sulfonyl-4-morpholin-4-ylthiolane 1,1-dioxide (CID 6552146) is (3S,4R)-3-(4-methylphenyl)sulfonyl-4-morpholin-4-ylthiolane 1,1-dioxide.
What is the SMILES notation for (3S,4R)-3-(4-methylphenyl)sulfonyl-4-morpholin-4-ylthiolane 1,1-dioxide?
The canonical SMILES for (3S,4R)-3-(4-methylphenyl)sulfonyl-4-morpholin-4-ylthiolane 1,1-dioxide is Cc1ccc(S(=O)(=O)[C@@H]2CS(=O)(=O)C[C@H]2N2CCOCC2)cc1.
What is the InChIKey of (3S,4R)-3-(4-methylphenyl)sulfonyl-4-morpholin-4-ylthiolane 1,1-dioxide?
The InChIKey is NDJRXBUSJQQVOW-HUUCEWRRSA-N. The full InChI is InChI=1S/C15H21NO5S2/c1-12-2-4-13(5-3-12)23(19,20)15-11-22(17,18)10-14(15)16-6-8-21-9-7-16/h2-5,14-15H,6-11H2,1H3/t14-,15-/m1/s1.
What are the key properties of (3S,4R)-3-(4-methylphenyl)sulfonyl-4-morpholin-4-ylthiolane 1,1-dioxide?
(3S,4R)-3-(4-methylphenyl)sulfonyl-4-morpholin-4-ylthiolane 1,1-dioxide has a molecular weight of 359.47 g/mol, XLogP of 0.27, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4R)-3-(4-methylphenyl)sulfonyl-4-morpholin-4-ylthiolane 1,1-dioxide is sourced from PubChem (CID 6552146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).