C21H17ClN2OS — CID 6552974
(11S,14R)-11-(4-chlorophenyl)-14-methyl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 6552974) has the molecular formula C21H17ClN2OS and a molecular weight of 380.90 g/mol. Its IUPAC name is (11S,14R)-11-(4-chlorophenyl)-14-methyl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | (11S,14R)-11-(4-chlorophenyl)-14-methyl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 6552974 |
| Molecular Formula | C21H17ClN2OS |
| Molecular Weight | 380.90 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | (11S,14R)-11-(4-chlorophenyl)-14-methyl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | C[C@H]1SC2=NC3=C(CCc4ccccc43)[C@H](c3ccc(Cl)cc3)N2C1=O |
| InChI | InChI=1S/C21H17ClN2OS/c1-12-20(25)24-19(14-6-9-15(22)10-7-14)17-11-8-13-4-2-3-5-16(13)18(17)23-21(24)26-12/h2-7,9-10,12,19H,8,11H2,1H3/t12-,19+/m1/s1 |
| InChIKey | ZWNGAVDMKOQOCV-BLVKFPJESA-N |
| XLogP | 5.07 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.90 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |