C14H20OS2 — CID 6553091
(8'aS)-8'a-methylspiro[1,3-dithiane-2,6'-3,4,7,8-tetrahydro-2H-naphthalene]-1'-one (PubChem CID 6553091) has the molecular formula C14H20OS2 and a molecular weight of 268.45 g/mol. Its IUPAC name is (8'aS)-8'a-methylspiro[1,3-dithiane-2,6'-3,4,7,8-tetrahydro-2H-naphthalene]-1'-one.
| Compound Name | (8'aS)-8'a-methylspiro[1,3-dithiane-2,6'-3,4,7,8-tetrahydro-2H-naphthalene]-1'-one |
|---|---|
| PubChem CID | 6553091 |
| Molecular Formula | C14H20OS2 |
| Molecular Weight | 268.45 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | (8'aS)-8'a-methylspiro[1,3-dithiane-2,6'-3,4,7,8-tetrahydro-2H-naphthalene]-1'-one |
| SMILES | C[C@]12CCC3(C=C1CCCC2=O)SCCCS3 |
| InChI | InChI=1S/C14H20OS2/c1-13-6-7-14(16-8-3-9-17-14)10-11(13)4-2-5-12(13)15/h10H,2-9H2,1H3/t13-/m0/s1 |
| InChIKey | OGBMEMLVUANHNC-ZDUSSCGKSA-N |
| XLogP | 4.03 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|