C14H15NO — CID 655331
2,4,8-trimethyl-2,3-dihydrofuro[2,3-b]quinoline (PubChem CID 655331) has the molecular formula C14H15NO and a molecular weight of 213.28 g/mol. Its IUPAC name is 2,4,8-trimethyl-2,3-dihydrofuro[2,3-b]quinoline.
| Compound Name | 2,4,8-trimethyl-2,3-dihydrofuro[2,3-b]quinoline |
|---|---|
| PubChem CID | 655331 |
| Molecular Formula | C14H15NO |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 2,4,8-trimethyl-2,3-dihydrofuro[2,3-b]quinoline |
| SMILES | Cc1c2c(nc3c(C)cccc13)OC(C)C2 |
| InChI | InChI=1S/C14H15NO/c1-8-5-4-6-11-10(3)12-7-9(2)16-14(12)15-13(8)11/h4-6,9H,7H2,1-3H3 |
| InChIKey | GHSCUKABNMKFNW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |