C20H30N2O6S — CID 655358
1-ethylsulfonyl-4-(4-phenylcyclohexyl)piperazine;oxalic acid (PubChem CID 655358) has the molecular formula C20H30N2O6S and a molecular weight of 426.54 g/mol. Its IUPAC name is 1-ethylsulfonyl-4-(4-phenylcyclohexyl)piperazine;oxalic acid.
| Compound Name | 1-ethylsulfonyl-4-(4-phenylcyclohexyl)piperazine;oxalic acid |
|---|---|
| PubChem CID | 655358 |
| Molecular Formula | C20H30N2O6S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 1-ethylsulfonyl-4-(4-phenylcyclohexyl)piperazine;oxalic acid |
| SMILES | CCS(=O)(=O)N1CCN(C2CCC(c3ccccc3)CC2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C18H28N2O2S.C2H2O4/c1-2-23(21,22)20-14-12-19(13-15-20)18-10-8-17(9-11-18)16-6-4-3-5-7-16;3-1(4)2(5)6/h3-7,17-18H,2,8-15H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | ZIYXJOCHZFOEFY-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|