C24H28N4O2 — CID 6553702
methyl 4-[(8R,8aR)-6-amino-5,5-dicyano-7,8a-dimethyl-2-propyl-3,8-dihydro-1H-isoquinolin-8-yl]benzoate (PubChem CID 6553702) has the molecular formula C24H28N4O2 and a molecular weight of 404.51 g/mol. Its IUPAC name is methyl 4-[(8R,8aR)-6-amino-5,5-dicyano-7,8a-dimethyl-2-propyl-3,8-dihydro-1H-isoquinolin-8-yl]benzoate.
| Compound Name | methyl 4-[(8R,8aR)-6-amino-5,5-dicyano-7,8a-dimethyl-2-propyl-3,8-dihydro-1H-isoquinolin-8-yl]benzoate |
|---|---|
| PubChem CID | 6553702 |
| Molecular Formula | C24H28N4O2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | methyl 4-[(8R,8aR)-6-amino-5,5-dicyano-7,8a-dimethyl-2-propyl-3,8-dihydro-1H-isoquinolin-8-yl]benzoate |
| SMILES | CCCN1CC=C2C(C#N)(C#N)C(N)=C(C)[C@H](c3ccc(C(=O)OC)cc3)[C@@]2(C)C1 |
| InChI | InChI=1S/C24H28N4O2/c1-5-11-28-12-10-19-23(3,15-28)20(16(2)21(27)24(19,13-25)14-26)17-6-8-18(9-7-17)22(29)30-4/h6-10,20H,5,11-12,15,27H2,1-4H3/t20-,23+/m1/s1 |
| InChIKey | RSYRKAJCZMSMRF-OFNKIYASSA-N |
| XLogP | 3.49 |
| TPSA | 103.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|