C14H18INO3S — CID 6553841
N-[(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]-3-iodo-4-methoxybenzenesulfonamide (PubChem CID 6553841) has the molecular formula C14H18INO3S and a molecular weight of 407.27 g/mol. Its IUPAC name is N-[(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]-3-iodo-4-methoxybenzenesulfonamide.
| Compound Name | N-[(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]-3-iodo-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 6553841 |
| Molecular Formula | C14H18INO3S |
| Molecular Weight | 407.27 g/mol |
| Exact Mass | 407.01 |
| IUPAC Name | N-[(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]-3-iodo-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N[C@@H]2C[C@@H]3CC[C@H]2C3)cc1I |
| InChI | InChI=1S/C14H18INO3S/c1-19-14-5-4-11(8-12(14)15)20(17,18)16-13-7-9-2-3-10(13)6-9/h4-5,8-10,13,16H,2-3,6-7H2,1H3/t9-,10+,13-/m1/s1 |
| InChIKey | BXEDGFJKQVMBNP-GBIKHYSHSA-N |
| XLogP | 2.77 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.27 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|