About 2-piperazin-1-yl-4,6-di(piperidin-1-yl)-1,3,5-triazine
2-piperazin-1-yl-4,6-di(piperidin-1-yl)-1,3,5-triazine (PubChem CID 655485) has the molecular formula C17H29N7
and a molecular weight of 331.47 g/mol. Its IUPAC name is 2-piperazin-1-yl-4,6-di(piperidin-1-yl)-1,3,5-triazine.
Molecular Properties
| Compound Name | 2-piperazin-1-yl-4,6-di(piperidin-1-yl)-1,3,5-triazine |
| PubChem CID | 655485 |
| Molecular Formula | C17H29N7 |
| Molecular Weight | 331.47 g/mol |
| Exact Mass | 331.25 |
| IUPAC Name | 2-piperazin-1-yl-4,6-di(piperidin-1-yl)-1,3,5-triazine |
| SMILES | C1CCN(c2nc(N3CCCCC3)nc(N3CCNCC3)n2)CC1 |
| InChI | InChI=1S/C17H29N7/c1-3-9-22(10-4-1)15-19-16(23-11-5-2-6-12-23)21-17(20-15)24-13-7-18-8-14-24/h18H,1-14H2 |
| InChIKey | OURNSQBCMZOFSW-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 60.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.47 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-piperazin-1-yl-4,6-di(piperidin-1-yl)-1,3,5-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperazin-1-yl-4,6-di(piperidin-1-yl)-1,3,5-triazine?
The IUPAC name of 2-piperazin-1-yl-4,6-di(piperidin-1-yl)-1,3,5-triazine (CID 655485) is 2-piperazin-1-yl-4,6-di(piperidin-1-yl)-1,3,5-triazine.
What is the SMILES notation for 2-piperazin-1-yl-4,6-di(piperidin-1-yl)-1,3,5-triazine?
The canonical SMILES for 2-piperazin-1-yl-4,6-di(piperidin-1-yl)-1,3,5-triazine is C1CCN(c2nc(N3CCCCC3)nc(N3CCNCC3)n2)CC1.
What is the InChIKey of 2-piperazin-1-yl-4,6-di(piperidin-1-yl)-1,3,5-triazine?
The InChIKey is OURNSQBCMZOFSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29N7/c1-3-9-22(10-4-1)15-19-16(23-11-5-2-6-12-23)21-17(20-15)24-13-7-18-8-14-24/h18H,1-14H2.
What are the key properties of 2-piperazin-1-yl-4,6-di(piperidin-1-yl)-1,3,5-triazine?
2-piperazin-1-yl-4,6-di(piperidin-1-yl)-1,3,5-triazine has a molecular weight of 331.47 g/mol, XLogP of 1.26, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperazin-1-yl-4,6-di(piperidin-1-yl)-1,3,5-triazine is sourced from PubChem (CID 655485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).