About 1-bromo-2-methylpropane
1-bromo-2-methylpropane (PubChem CID 6555) has the molecular formula C4H9Br
and a molecular weight of 137.02 g/mol. Its IUPAC name is 1-bromo-2-methylpropane.
Molecular Properties
| Compound Name | 1-bromo-2-methylpropane |
| PubChem CID | 6555 |
| Molecular Formula | C4H9Br |
| Molecular Weight | 137.02 g/mol |
| Exact Mass | 135.99 |
| IUPAC Name | 1-bromo-2-methylpropane |
| SMILES | CC(C)CBr |
| InChI | InChI=1S/C4H9Br/c1-4(2)3-5/h4H,3H2,1-2H3 |
| InChIKey | HLVFKOKELQSXIQ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.02 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2-methylpropane?
The IUPAC name of 1-bromo-2-methylpropane (CID 6555) is 1-bromo-2-methylpropane.
What is the SMILES notation for 1-bromo-2-methylpropane?
The canonical SMILES for 1-bromo-2-methylpropane is CC(C)CBr.
What is the InChIKey of 1-bromo-2-methylpropane?
The InChIKey is HLVFKOKELQSXIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9Br/c1-4(2)3-5/h4H,3H2,1-2H3.
What are the key properties of 1-bromo-2-methylpropane?
1-bromo-2-methylpropane has a molecular weight of 137.02 g/mol, XLogP of 2.04, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2-methylpropane is sourced from PubChem (CID 6555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).