About (3S,4S)-1,1-dioxo-4-piperidin-1-ylthiolan-3-ol
(3S,4S)-1,1-dioxo-4-piperidin-1-ylthiolan-3-ol (PubChem CID 6555452) has the molecular formula C9H17NO3S
and a molecular weight of 219.31 g/mol. Its IUPAC name is (3S,4S)-1,1-dioxo-4-piperidin-1-ylthiolan-3-ol.
Molecular Properties
| Compound Name | (3S,4S)-1,1-dioxo-4-piperidin-1-ylthiolan-3-ol |
| PubChem CID | 6555452 |
| Molecular Formula | C9H17NO3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | (3S,4S)-1,1-dioxo-4-piperidin-1-ylthiolan-3-ol |
| SMILES | O=S1(=O)C[C@@H](O)[C@H](N2CCCCC2)C1 |
| InChI | InChI=1S/C9H17NO3S/c11-9-7-14(12,13)6-8(9)10-4-2-1-3-5-10/h8-9,11H,1-7H2/t8-,9-/m1/s1 |
| InChIKey | SNEPMRMWHXCLPC-RKDXNWHRSA-N |
| XLogP | -0.37 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3S,4S)-1,1-dioxo-4-piperidin-1-ylthiolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-1,1-dioxo-4-piperidin-1-ylthiolan-3-ol?
The IUPAC name of (3S,4S)-1,1-dioxo-4-piperidin-1-ylthiolan-3-ol (CID 6555452) is (3S,4S)-1,1-dioxo-4-piperidin-1-ylthiolan-3-ol.
What is the SMILES notation for (3S,4S)-1,1-dioxo-4-piperidin-1-ylthiolan-3-ol?
The canonical SMILES for (3S,4S)-1,1-dioxo-4-piperidin-1-ylthiolan-3-ol is O=S1(=O)C[C@@H](O)[C@H](N2CCCCC2)C1.
What is the InChIKey of (3S,4S)-1,1-dioxo-4-piperidin-1-ylthiolan-3-ol?
The InChIKey is SNEPMRMWHXCLPC-RKDXNWHRSA-N. The full InChI is InChI=1S/C9H17NO3S/c11-9-7-14(12,13)6-8(9)10-4-2-1-3-5-10/h8-9,11H,1-7H2/t8-,9-/m1/s1.
What are the key properties of (3S,4S)-1,1-dioxo-4-piperidin-1-ylthiolan-3-ol?
(3S,4S)-1,1-dioxo-4-piperidin-1-ylthiolan-3-ol has a molecular weight of 219.31 g/mol, XLogP of -0.37, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-1,1-dioxo-4-piperidin-1-ylthiolan-3-ol is sourced from PubChem (CID 6555452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).