About N-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methyl]-3-phenylpropanamide
N-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methyl]-3-phenylpropanamide (PubChem CID 655557) has the molecular formula C21H28N4O
and a molecular weight of 352.48 g/mol. Its IUPAC name is N-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methyl]-3-phenylpropanamide.
Molecular Properties
| Compound Name | N-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methyl]-3-phenylpropanamide |
| PubChem CID | 655557 |
| Molecular Formula | C21H28N4O |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | N-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methyl]-3-phenylpropanamide |
| SMILES | Cc1cc(C)nc(N2CCC(CNC(=O)CCc3ccccc3)CC2)n1 |
| InChI | InChI=1S/C21H28N4O/c1-16-14-17(2)24-21(23-16)25-12-10-19(11-13-25)15-22-20(26)9-8-18-6-4-3-5-7-18/h3-7,14,19H,8-13,15H2,1-2H3,(H,22,26) |
| InChIKey | CQJGWHPBQJCLIT-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methyl]-3-phenylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methyl]-3-phenylpropanamide?
The IUPAC name of N-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methyl]-3-phenylpropanamide (CID 655557) is N-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methyl]-3-phenylpropanamide.
What is the SMILES notation for N-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methyl]-3-phenylpropanamide?
The canonical SMILES for N-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methyl]-3-phenylpropanamide is Cc1cc(C)nc(N2CCC(CNC(=O)CCc3ccccc3)CC2)n1.
What is the InChIKey of N-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methyl]-3-phenylpropanamide?
The InChIKey is CQJGWHPBQJCLIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28N4O/c1-16-14-17(2)24-21(23-16)25-12-10-19(11-13-25)15-22-20(26)9-8-18-6-4-3-5-7-18/h3-7,14,19H,8-13,15H2,1-2H3,(H,22,26).
What are the key properties of N-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methyl]-3-phenylpropanamide?
N-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methyl]-3-phenylpropanamide has a molecular weight of 352.48 g/mol, XLogP of 3.06, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methyl]-3-phenylpropanamide is sourced from PubChem (CID 655557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).