C27H26N2O5 — CID 6555788
(3R)-3-[(1R)-1-(4-hydroxyphenyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-1-phenylpyrrolidine-2,5-dione (PubChem CID 6555788) has the molecular formula C27H26N2O5 and a molecular weight of 458.51 g/mol. Its IUPAC name is (3R)-3-[(1R)-1-(4-hydroxyphenyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-1-phenylpyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[(1R)-1-(4-hydroxyphenyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-1-phenylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 6555788 |
| Molecular Formula | C27H26N2O5 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | (3R)-3-[(1R)-1-(4-hydroxyphenyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-1-phenylpyrrolidine-2,5-dione |
| SMILES | COc1cc2c(cc1OC)[C@@H](c1ccc(O)cc1)N([C@@H]1CC(=O)N(c3ccccc3)C1=O)CC2 |
| InChI | InChI=1S/C27H26N2O5/c1-33-23-14-18-12-13-28(22-16-25(31)29(27(22)32)19-6-4-3-5-7-19)26(21(18)15-24(23)34-2)17-8-10-20(30)11-9-17/h3-11,14-15,22,26,30H,12-13,16H2,1-2H3/t22-,26-/m1/s1 |
| InChIKey | GMERYILDTLUUJL-ATIYNZHBSA-N |
| XLogP | 3.69 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|