C24H22N2O — CID 6556041
(3S,3aS,7E)-7-(furan-2-ylmethylidene)-2,3-diphenyl-3a,4,5,6-tetrahydro-3H-indazole (PubChem CID 6556041) has the molecular formula C24H22N2O and a molecular weight of 354.45 g/mol. Its IUPAC name is (3S,3aS,7E)-7-(furan-2-ylmethylidene)-2,3-diphenyl-3a,4,5,6-tetrahydro-3H-indazole.
| Compound Name | (3S,3aS,7E)-7-(furan-2-ylmethylidene)-2,3-diphenyl-3a,4,5,6-tetrahydro-3H-indazole |
|---|---|
| PubChem CID | 6556041 |
| Molecular Formula | C24H22N2O |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | (3S,3aS,7E)-7-(furan-2-ylmethylidene)-2,3-diphenyl-3a,4,5,6-tetrahydro-3H-indazole |
| SMILES | C(=C1\CCC[C@@H]2C1=NN(c1ccccc1)[C@@H]2c1ccccc1)\c1ccco1 |
| InChI | InChI=1S/C24H22N2O/c1-3-9-18(10-4-1)24-22-15-7-11-19(17-21-14-8-16-27-21)23(22)25-26(24)20-12-5-2-6-13-20/h1-6,8-10,12-14,16-17,22,24H,7,11,15H2/b19-17+/t22-,24-/m1/s1 |
| InChIKey | YKWQHZUENZGCQI-CITMJMANSA-N |
| XLogP | 6.08 |
| TPSA | 28.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |