C23H40NO2+ — CID 6556776
1-methyl-1-[[(2R,4R)-2-[(1R,6R)-6-methyl-4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]-1,3-dioxolan-4-yl]methyl]piperidin-1-ium (PubChem CID 6556776) has the molecular formula C23H40NO2+ and a molecular weight of 362.58 g/mol. Its IUPAC name is 1-methyl-1-[[(2R,4R)-2-[(1R,6R)-6-methyl-4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]-1,3-dioxolan-4-yl]methyl]piperidin-1-ium.
| Compound Name | 1-methyl-1-[[(2R,4R)-2-[(1R,6R)-6-methyl-4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]-1,3-dioxolan-4-yl]methyl]piperidin-1-ium |
|---|---|
| PubChem CID | 6556776 |
| Molecular Formula | C23H40NO2+ |
| Molecular Weight | 362.58 g/mol |
| Exact Mass | 362.31 |
| IUPAC Name | 1-methyl-1-[[(2R,4R)-2-[(1R,6R)-6-methyl-4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]-1,3-dioxolan-4-yl]methyl]piperidin-1-ium |
| SMILES | CC(C)=CCCC1=CC[C@@H]([C@@H]2OC[C@@H](C[N+]3(C)CCCCC3)O2)[C@H](C)C1 |
| InChI | InChI=1S/C23H40NO2/c1-18(2)9-8-10-20-11-12-22(19(3)15-20)23-25-17-21(26-23)16-24(4)13-6-5-7-14-24/h9,11,19,21-23H,5-8,10,12-17H2,1-4H3/q+1/t19-,21-,22-,23-/m1/s1 |
| InChIKey | FSCUZZBYWCMCOK-JMJGKCIBSA-N |
| XLogP | 5.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.58 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|