C14H29NO — CID 6556835
(3R,5R)-1-tert-butyl-5-(2,2-dimethylpropyl)piperidin-3-ol (PubChem CID 6556835) has the molecular formula C14H29NO and a molecular weight of 227.39 g/mol. Its IUPAC name is (3R,5R)-1-tert-butyl-5-(2,2-dimethylpropyl)piperidin-3-ol.
| Compound Name | (3R,5R)-1-tert-butyl-5-(2,2-dimethylpropyl)piperidin-3-ol |
|---|---|
| PubChem CID | 6556835 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | (3R,5R)-1-tert-butyl-5-(2,2-dimethylpropyl)piperidin-3-ol |
| SMILES | CC(C)(C)C[C@@H]1C[C@@H](O)CN(C(C)(C)C)C1 |
| InChI | InChI=1S/C14H29NO/c1-13(2,3)8-11-7-12(16)10-15(9-11)14(4,5)6/h11-12,16H,7-10H2,1-6H3/t11-,12+/m0/s1 |
| InChIKey | HQGXKUPASNHPPJ-NWDGAFQWSA-N |
| XLogP | 2.90 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |