C19H21N3O6 — CID 6556982
2-[(2R,3R,5S,6S)-6-(2-hydroxyphenyl)-4,4-dimethyl-3,5-dinitropiperidin-2-yl]phenol (PubChem CID 6556982) has the molecular formula C19H21N3O6 and a molecular weight of 387.39 g/mol. Its IUPAC name is 2-[(2R,3R,5S,6S)-6-(2-hydroxyphenyl)-4,4-dimethyl-3,5-dinitropiperidin-2-yl]phenol.
| Compound Name | 2-[(2R,3R,5S,6S)-6-(2-hydroxyphenyl)-4,4-dimethyl-3,5-dinitropiperidin-2-yl]phenol |
|---|---|
| PubChem CID | 6556982 |
| Molecular Formula | C19H21N3O6 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 2-[(2R,3R,5S,6S)-6-(2-hydroxyphenyl)-4,4-dimethyl-3,5-dinitropiperidin-2-yl]phenol |
| SMILES | CC1(C)[C@@H]([N+](=O)[O-])[C@@H](c2ccccc2O)N[C@@H](c2ccccc2O)[C@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C19H21N3O6/c1-19(2)17(21(25)26)15(11-7-3-5-9-13(11)23)20-16(18(19)22(27)28)12-8-4-6-10-14(12)24/h3-10,15-18,20,23-24H,1-2H3/t15-,16+,17+,18- |
| InChIKey | QWRZREMQSRFAAJ-FZDBZEDMSA-N |
| XLogP | 2.80 |
| TPSA | 138.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|