About 2-(4-methoxyanilino)-1-(thiophen-2-ylmethyl)-4,5-dihydropyrimidin-6-one
2-(4-methoxyanilino)-1-(thiophen-2-ylmethyl)-4,5-dihydropyrimidin-6-one (PubChem CID 655721) has the molecular formula C16H17N3O2S
and a molecular weight of 315.40 g/mol. Its IUPAC name is 2-(4-methoxyanilino)-1-(thiophen-2-ylmethyl)-4,5-dihydropyrimidin-6-one.
Molecular Properties
| Compound Name | 2-(4-methoxyanilino)-1-(thiophen-2-ylmethyl)-4,5-dihydropyrimidin-6-one |
| PubChem CID | 655721 |
| Molecular Formula | C16H17N3O2S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 2-(4-methoxyanilino)-1-(thiophen-2-ylmethyl)-4,5-dihydropyrimidin-6-one |
| SMILES | COc1ccc(NC2=NCCC(=O)N2Cc2cccs2)cc1 |
| InChI | InChI=1S/C16H17N3O2S/c1-21-13-6-4-12(5-7-13)18-16-17-9-8-15(20)19(16)11-14-3-2-10-22-14/h2-7,10H,8-9,11H2,1H3,(H,17,18) |
| InChIKey | XMLIOQHYVGURHF-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-methoxyanilino)-1-(thiophen-2-ylmethyl)-4,5-dihydropyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methoxyanilino)-1-(thiophen-2-ylmethyl)-4,5-dihydropyrimidin-6-one?
The IUPAC name of 2-(4-methoxyanilino)-1-(thiophen-2-ylmethyl)-4,5-dihydropyrimidin-6-one (CID 655721) is 2-(4-methoxyanilino)-1-(thiophen-2-ylmethyl)-4,5-dihydropyrimidin-6-one.
What is the SMILES notation for 2-(4-methoxyanilino)-1-(thiophen-2-ylmethyl)-4,5-dihydropyrimidin-6-one?
The canonical SMILES for 2-(4-methoxyanilino)-1-(thiophen-2-ylmethyl)-4,5-dihydropyrimidin-6-one is COc1ccc(NC2=NCCC(=O)N2Cc2cccs2)cc1.
What is the InChIKey of 2-(4-methoxyanilino)-1-(thiophen-2-ylmethyl)-4,5-dihydropyrimidin-6-one?
The InChIKey is XMLIOQHYVGURHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3O2S/c1-21-13-6-4-12(5-7-13)18-16-17-9-8-15(20)19(16)11-14-3-2-10-22-14/h2-7,10H,8-9,11H2,1H3,(H,17,18).
What are the key properties of 2-(4-methoxyanilino)-1-(thiophen-2-ylmethyl)-4,5-dihydropyrimidin-6-one?
2-(4-methoxyanilino)-1-(thiophen-2-ylmethyl)-4,5-dihydropyrimidin-6-one has a molecular weight of 315.40 g/mol, XLogP of 2.96, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methoxyanilino)-1-(thiophen-2-ylmethyl)-4,5-dihydropyrimidin-6-one is sourced from PubChem (CID 655721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).