C19H21N3O6S — CID 655771
2-(pyridine-3-carbonylamino)ethyl 4-morpholin-4-ylsulfonylbenzoate (PubChem CID 655771) has the molecular formula C19H21N3O6S and a molecular weight of 419.46 g/mol. Its IUPAC name is 2-(pyridine-3-carbonylamino)ethyl 4-morpholin-4-ylsulfonylbenzoate.
| Compound Name | 2-(pyridine-3-carbonylamino)ethyl 4-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 655771 |
| Molecular Formula | C19H21N3O6S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 2-(pyridine-3-carbonylamino)ethyl 4-morpholin-4-ylsulfonylbenzoate |
| SMILES | O=C(NCCOC(=O)c1ccc(S(=O)(=O)N2CCOCC2)cc1)c1cccnc1 |
| InChI | InChI=1S/C19H21N3O6S/c23-18(16-2-1-7-20-14-16)21-8-11-28-19(24)15-3-5-17(6-4-15)29(25,26)22-9-12-27-13-10-22/h1-7,14H,8-13H2,(H,21,23) |
| InChIKey | PUPAFNJWTDZZOO-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 114.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|